1-[6-(2,3-dimethoxyphenyl)-10-methyl-3-[(2-methylpropyl)sulfanyl][1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one
Chemical Structure Depiction of
1-[6-(2,3-dimethoxyphenyl)-10-methyl-3-[(2-methylpropyl)sulfanyl][1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one
1-[6-(2,3-dimethoxyphenyl)-10-methyl-3-[(2-methylpropyl)sulfanyl][1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | F579-1653 |
| Compound Name: | 1-[6-(2,3-dimethoxyphenyl)-10-methyl-3-[(2-methylpropyl)sulfanyl][1,2,4]triazino[5,6-d][3,1]benzoxazepin-7(6H)-yl]ethan-1-one |
| Molecular Weight: | 480.59 |
| Molecular Formula: | C25 H28 N4 O4 S |
| Smiles: | CC(C)CSc1nc2c(c3cc(C)ccc3N(C(c3cccc(c3OC)OC)O2)C(C)=O)nn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7111 |
| logD: | 4.7111 |
| logSw: | -4.5355 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 69.987 |
| InChI Key: | VDIDPXVIHIPAEM-DEOSSOPVSA-N |