1-[(4-chlorophenyl)methyl]-3-[1-(3,4-difluorobenzene-1-sulfonyl)-1,2,3,6-tetrahydropyridin-4-yl]-2-methyl-1H-indole
Chemical Structure Depiction of
1-[(4-chlorophenyl)methyl]-3-[1-(3,4-difluorobenzene-1-sulfonyl)-1,2,3,6-tetrahydropyridin-4-yl]-2-methyl-1H-indole
1-[(4-chlorophenyl)methyl]-3-[1-(3,4-difluorobenzene-1-sulfonyl)-1,2,3,6-tetrahydropyridin-4-yl]-2-methyl-1H-indole
Compound characteristics
| Compound ID: | F588-0141 |
| Compound Name: | 1-[(4-chlorophenyl)methyl]-3-[1-(3,4-difluorobenzene-1-sulfonyl)-1,2,3,6-tetrahydropyridin-4-yl]-2-methyl-1H-indole |
| Molecular Weight: | 513.01 |
| Molecular Formula: | C27 H23 Cl F2 N2 O2 S |
| Smiles: | Cc1c(C2CCN(CC=2)S(c2ccc(c(c2)F)F)(=O)=O)c2ccccc2n1Cc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.9496 |
| logD: | 6.9496 |
| logSw: | -6.6103 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.878 |
| InChI Key: | MALPUWLMNQGGEI-UHFFFAOYSA-N |