1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(3-methylbenzene-1-sulfonyl)piperidin-4-yl]-1H-indole
Chemical Structure Depiction of
1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(3-methylbenzene-1-sulfonyl)piperidin-4-yl]-1H-indole
1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(3-methylbenzene-1-sulfonyl)piperidin-4-yl]-1H-indole
Compound characteristics
| Compound ID: | F589-0139 |
| Compound Name: | 1-[(4-chlorophenyl)methyl]-2-methyl-3-[1-(3-methylbenzene-1-sulfonyl)piperidin-4-yl]-1H-indole |
| Molecular Weight: | 493.07 |
| Molecular Formula: | C28 H29 Cl N2 O2 S |
| Smiles: | Cc1cccc(c1)S(N1CCC(CC1)c1c2ccccc2n(Cc2ccc(cc2)[Cl])c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.934 |
| logD: | 6.934 |
| logSw: | -6.5125 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.878 |
| InChI Key: | YHEIPJOOUVPJLA-UHFFFAOYSA-N |