3,5-dimethoxy-N-[(4-methylphenyl)methyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
3,5-dimethoxy-N-[(4-methylphenyl)methyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1)
3,5-dimethoxy-N-[(4-methylphenyl)methyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F594-0185 |
| Compound Name: | 3,5-dimethoxy-N-[(4-methylphenyl)methyl]-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1) |
| Molecular Weight: | 539.55 |
| Molecular Formula: | C24 H31 N3 O4 |
| Salt: | CF3COOH |
| Smiles: | Cc1ccc(CN(CCC(N2CCNCC2)=O)C(c2cc(cc(c2)OC)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 1.731 |
| logD: | 0.903 |
| logSw: | -2.2783 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.597 |
| InChI Key: | SWGXODQHPRAXMP-UHFFFAOYSA-N |