N-[2-(diethylamino)ethyl]-3-methyl-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
N-[2-(diethylamino)ethyl]-3-methyl-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1)
N-[2-(diethylamino)ethyl]-3-methyl-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F594-0230 |
| Compound Name: | N-[2-(diethylamino)ethyl]-3-methyl-N-[3-oxo-3-(piperazin-1-yl)propyl]benzamide--trifluoroacetic acid (1/1) |
| Molecular Weight: | 488.55 |
| Molecular Formula: | C21 H34 N4 O2 |
| Salt: | CF3COOH |
| Smiles: | CCN(CC)CCN(CCC(N1CCNCC1)=O)C(c1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.6976 |
| logD: | -0.1874 |
| logSw: | -1.9482 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.171 |
| InChI Key: | UKYMZHDSDNDKOL-UHFFFAOYSA-N |