3-benzyl-N-(3-methoxypropyl)-2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxamide
Chemical Structure Depiction of
3-benzyl-N-(3-methoxypropyl)-2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxamide
3-benzyl-N-(3-methoxypropyl)-2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxamide
Compound characteristics
| Compound ID: | F601-0112 |
| Compound Name: | 3-benzyl-N-(3-methoxypropyl)-2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxamide |
| Molecular Weight: | 340.38 |
| Molecular Formula: | C19 H20 N2 O4 |
| Smiles: | COCCCNC(c1ccc2c(c1)N(Cc1ccccc1)C(=O)O2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4834 |
| logD: | 2.4834 |
| logSw: | -3.0782 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.936 |
| InChI Key: | QKURZAAXMTYQCO-UHFFFAOYSA-N |