N-cyclohexyl-2-oxo-3-(prop-2-en-1-yl)-2,3-dihydro-1,3-benzoxazole-5-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-2-oxo-3-(prop-2-en-1-yl)-2,3-dihydro-1,3-benzoxazole-5-carboxamide
N-cyclohexyl-2-oxo-3-(prop-2-en-1-yl)-2,3-dihydro-1,3-benzoxazole-5-carboxamide
Compound characteristics
| Compound ID: | F601-1004 |
| Compound Name: | N-cyclohexyl-2-oxo-3-(prop-2-en-1-yl)-2,3-dihydro-1,3-benzoxazole-5-carboxamide |
| Molecular Weight: | 300.36 |
| Molecular Formula: | C17 H20 N2 O3 |
| Smiles: | C=CCN1C(=O)Oc2ccc(cc12)C(NC1CCCCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0077 |
| logD: | 3.0077 |
| logSw: | -3.472 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.456 |
| InChI Key: | YSJIVFQFUTVVBN-UHFFFAOYSA-N |