N,N'-(4-methoxy-1,3-phenylene)bis(4-methoxybenzamide)
Chemical Structure Depiction of
N,N'-(4-methoxy-1,3-phenylene)bis(4-methoxybenzamide)
N,N'-(4-methoxy-1,3-phenylene)bis(4-methoxybenzamide)
Compound characteristics
| Compound ID: | F603-0036 |
| Compound Name: | N,N'-(4-methoxy-1,3-phenylene)bis(4-methoxybenzamide) |
| Molecular Weight: | 406.44 |
| Molecular Formula: | C23 H22 N2 O5 |
| Smiles: | COc1ccc(cc1)C(Nc1ccc(c(c1)NC(c1ccc(cc1)OC)=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7702 |
| logD: | 3.7692 |
| logSw: | -4.1244 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.441 |
| InChI Key: | DWRKVBJPJXGHMA-UHFFFAOYSA-N |