N-(3-benzamido-4-methoxyphenyl)-3,4,5-triethoxybenzamide
Chemical Structure Depiction of
N-(3-benzamido-4-methoxyphenyl)-3,4,5-triethoxybenzamide
N-(3-benzamido-4-methoxyphenyl)-3,4,5-triethoxybenzamide
Compound characteristics
| Compound ID: | F603-1207 |
| Compound Name: | N-(3-benzamido-4-methoxyphenyl)-3,4,5-triethoxybenzamide |
| Molecular Weight: | 478.54 |
| Molecular Formula: | C27 H30 N2 O6 |
| Smiles: | CCOc1cc(cc(c1OCC)OCC)C(Nc1ccc(c(c1)NC(c1ccccc1)=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.44 |
| logD: | 4.4379 |
| logSw: | -4.2967 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.071 |
| InChI Key: | QCHCXTGHVPRJQN-UHFFFAOYSA-N |