N-(2,4-dimethylphenyl)-2-[1-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]quinoline-4-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-[1-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]quinoline-4-carboxamide
N-(2,4-dimethylphenyl)-2-[1-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]quinoline-4-carboxamide
Compound characteristics
| Compound ID: | F612-0365 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-[1-(4-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]quinoline-4-carboxamide |
| Molecular Weight: | 450.52 |
| Molecular Formula: | C28 H23 F N4 O |
| Smiles: | Cc1ccc(c(C)c1)NC(c1cc(c2cnn(c3ccc(cc3)F)c2C)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4624 |
| logD: | 6.4624 |
| logSw: | -5.7273 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.756 |
| InChI Key: | RLPNUKXVIIIFFE-UHFFFAOYSA-N |