4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-(3-methoxyphenyl)benzamide
Chemical Structure Depiction of
4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-(3-methoxyphenyl)benzamide
4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-(3-methoxyphenyl)benzamide
Compound characteristics
| Compound ID: | F616-0011 |
| Compound Name: | 4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-(3-methoxyphenyl)benzamide |
| Molecular Weight: | 447.49 |
| Molecular Formula: | C24 H18 F N3 O3 S |
| Smiles: | COc1cccc(c1)NC(c1ccc(cc1)N1C(C=CC(=N1)Sc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7181 |
| logD: | 4.7171 |
| logSw: | -4.6025 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.183 |
| InChI Key: | YTVXAERGAVQXKO-UHFFFAOYSA-N |