N-cyclohexyl-4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide
Chemical Structure Depiction of
N-cyclohexyl-4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide
N-cyclohexyl-4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide
Compound characteristics
| Compound ID: | F616-0123 |
| Compound Name: | N-cyclohexyl-4-{3-[(4-fluorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide |
| Molecular Weight: | 423.51 |
| Molecular Formula: | C23 H22 F N3 O2 S |
| Smiles: | C1CCC(CC1)NC(c1ccc(cc1)N1C(C=CC(=N1)Sc1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6503 |
| logD: | 4.6503 |
| logSw: | -4.5937 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.687 |
| InChI Key: | AANXSMWCQDPYHP-UHFFFAOYSA-N |