4-{3-[(4-methoxyphenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-[(4-methylphenyl)methyl]benzamide
Chemical Structure Depiction of
4-{3-[(4-methoxyphenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-[(4-methylphenyl)methyl]benzamide
4-{3-[(4-methoxyphenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-[(4-methylphenyl)methyl]benzamide
Compound characteristics
| Compound ID: | F616-0232 |
| Compound Name: | 4-{3-[(4-methoxyphenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}-N-[(4-methylphenyl)methyl]benzamide |
| Molecular Weight: | 457.55 |
| Molecular Formula: | C26 H23 N3 O3 S |
| Smiles: | Cc1ccc(CNC(c2ccc(cc2)N2C(C=CC(=N2)Sc2ccc(cc2)OC)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6943 |
| logD: | 4.6942 |
| logSw: | -4.3686 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.505 |
| InChI Key: | AALOLMCYYNSARJ-UHFFFAOYSA-N |