N-(4-acetamidophenyl)-4-{3-[(4-chlorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide
Chemical Structure Depiction of
N-(4-acetamidophenyl)-4-{3-[(4-chlorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide
N-(4-acetamidophenyl)-4-{3-[(4-chlorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide
Compound characteristics
| Compound ID: | F616-0592 |
| Compound Name: | N-(4-acetamidophenyl)-4-{3-[(4-chlorophenyl)sulfanyl]-6-oxopyridazin-1(6H)-yl}benzamide |
| Molecular Weight: | 490.97 |
| Molecular Formula: | C25 H19 Cl N4 O3 S |
| Smiles: | CC(Nc1ccc(cc1)NC(c1ccc(cc1)N1C(C=CC(=N1)Sc1ccc(cc1)[Cl])=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4186 |
| logD: | 4.4184 |
| logSw: | -4.6653 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.901 |
| InChI Key: | MJNFDQDUGGSJGQ-UHFFFAOYSA-N |