(4-methylpiperidin-1-yl)[1-phenyl-5-(pyridin-3-yl)-1H-pyrazol-3-yl]methanone
Chemical Structure Depiction of
(4-methylpiperidin-1-yl)[1-phenyl-5-(pyridin-3-yl)-1H-pyrazol-3-yl]methanone
(4-methylpiperidin-1-yl)[1-phenyl-5-(pyridin-3-yl)-1H-pyrazol-3-yl]methanone
Compound characteristics
| Compound ID: | F624-2036 |
| Compound Name: | (4-methylpiperidin-1-yl)[1-phenyl-5-(pyridin-3-yl)-1H-pyrazol-3-yl]methanone |
| Molecular Weight: | 346.43 |
| Molecular Formula: | C21 H22 N4 O |
| Smiles: | CC1CCN(CC1)C(c1cc(c2cccnc2)n(c2ccccc2)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2643 |
| logD: | 3.2643 |
| logSw: | -3.2277 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.228 |
| InChI Key: | HBTARXMLCUQXAT-UHFFFAOYSA-N |