N-[(4-methoxyphenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-[(4-methoxyphenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
N-[(4-methoxyphenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | F624-2423 |
| Compound Name: | N-[(4-methoxyphenyl)methyl]-1-(4-methylphenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 398.46 |
| Molecular Formula: | C24 H22 N4 O2 |
| Smiles: | Cc1ccc(cc1)n1c(cc(C(NCc2ccc(cc2)OC)=O)n1)c1cccnc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9451 |
| logD: | 3.9451 |
| logSw: | -3.7674 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.536 |
| InChI Key: | NOXSWRKUKKJNHY-UHFFFAOYSA-N |