N-cycloheptyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-cycloheptyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
N-cycloheptyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | F624-2790 |
| Compound Name: | N-cycloheptyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 378.45 |
| Molecular Formula: | C22 H23 F N4 O |
| Smiles: | C1CCCC(CC1)NC(c1cc(c2cccnc2)n(c2ccc(cc2)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3528 |
| logD: | 4.3528 |
| logSw: | -4.1754 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.049 |
| InChI Key: | CESHBQKEZAUCAQ-UHFFFAOYSA-N |