N-cyclohexyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
N-cyclohexyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide
Compound characteristics
| Compound ID: | F624-2791 |
| Compound Name: | N-cyclohexyl-1-(4-fluorophenyl)-5-(pyridin-3-yl)-1H-pyrazole-3-carboxamide |
| Molecular Weight: | 364.42 |
| Molecular Formula: | C21 H21 F N4 O |
| Smiles: | C1CCC(CC1)NC(c1cc(c2cccnc2)n(c2ccc(cc2)F)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8569 |
| logD: | 3.8568 |
| logSw: | -3.8499 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.718 |
| InChI Key: | LRMMHELGNMPOJB-UHFFFAOYSA-N |