N-(4-ethylphenyl)-5-[2-oxo-2-(pyrrolidin-1-yl)ethyl]thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-5-[2-oxo-2-(pyrrolidin-1-yl)ethyl]thiophene-2-sulfonamide
N-(4-ethylphenyl)-5-[2-oxo-2-(pyrrolidin-1-yl)ethyl]thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | F625-0054 |
| Compound Name: | N-(4-ethylphenyl)-5-[2-oxo-2-(pyrrolidin-1-yl)ethyl]thiophene-2-sulfonamide |
| Molecular Weight: | 378.51 |
| Molecular Formula: | C18 H22 N2 O3 S2 |
| Smiles: | CCc1ccc(cc1)NS(c1ccc(CC(N2CCCC2)=O)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0388 |
| logD: | 4.0353 |
| logSw: | -3.8237 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.393 |
| InChI Key: | GIBZVNZNVDNRGY-UHFFFAOYSA-N |