4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-N-(2,5-dimethoxyphenyl)piperazine-1-carboxamide
Chemical Structure Depiction of
4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-N-(2,5-dimethoxyphenyl)piperazine-1-carboxamide
4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-N-(2,5-dimethoxyphenyl)piperazine-1-carboxamide
Compound characteristics
| Compound ID: | F627-0190 |
| Compound Name: | 4-[4-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-N-(2,5-dimethoxyphenyl)piperazine-1-carboxamide |
| Molecular Weight: | 449.51 |
| Molecular Formula: | C24 H27 N5 O4 |
| Smiles: | COc1ccc(c(c1)NC(N1CCN(CC1)c1ccc(cc1)c1nc(C2CC2)on1)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.7421 |
| logD: | 4.742 |
| logSw: | -4.5319 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.373 |
| InChI Key: | OFBIFCNKMDFZDF-UHFFFAOYSA-N |