N-[2-(3,4-dimethylanilino)-2-oxoethyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide
Chemical Structure Depiction of
N-[2-(3,4-dimethylanilino)-2-oxoethyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide
N-[2-(3,4-dimethylanilino)-2-oxoethyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide
Compound characteristics
| Compound ID: | F628-0500 |
| Compound Name: | N-[2-(3,4-dimethylanilino)-2-oxoethyl]-4-(5-ethyl-1,2,4-oxadiazol-3-yl)benzamide |
| Molecular Weight: | 378.43 |
| Molecular Formula: | C21 H22 N4 O3 |
| Smiles: | CCc1nc(c2ccc(cc2)C(NCC(Nc2ccc(C)c(C)c2)=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.5961 |
| logD: | 4.5961 |
| logSw: | -4.291 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.144 |
| InChI Key: | LIENBFPOCYGONN-UHFFFAOYSA-N |