N-(2-ethylphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(2-ethylphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonamide
N-(2-ethylphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | F630-0053 |
| Compound Name: | N-(2-ethylphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 349.43 |
| Molecular Formula: | C15 H15 N3 O3 S2 |
| Smiles: | CCc1ccccc1NS(c1ccc(c2nnc(C)o2)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2855 |
| logD: | 3.2842 |
| logSw: | -3.4148 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.952 |
| InChI Key: | FCAHTVVLSXUWQO-UHFFFAOYSA-N |