1-(3-methoxyphenyl)-4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonyl]piperazine
Chemical Structure Depiction of
1-(3-methoxyphenyl)-4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonyl]piperazine
1-(3-methoxyphenyl)-4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonyl]piperazine
Compound characteristics
| Compound ID: | F630-0067 |
| Compound Name: | 1-(3-methoxyphenyl)-4-[5-(5-methyl-1,3,4-oxadiazol-2-yl)thiophene-2-sulfonyl]piperazine |
| Molecular Weight: | 420.51 |
| Molecular Formula: | C18 H20 N4 O4 S2 |
| Smiles: | Cc1nnc(c2ccc(s2)S(N2CCN(CC2)c2cccc(c2)OC)(=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.644 |
| logD: | 2.644 |
| logSw: | -2.9539 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 73.515 |
| InChI Key: | IHWGJXROUHSKKB-UHFFFAOYSA-N |