5-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-N-(2-methoxy-5-methylphenyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
5-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-N-(2-methoxy-5-methylphenyl)thiophene-2-sulfonamide
5-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-N-(2-methoxy-5-methylphenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | F630-0970 |
| Compound Name: | 5-(5-cyclobutyl-1,3,4-oxadiazol-2-yl)-N-(2-methoxy-5-methylphenyl)thiophene-2-sulfonamide |
| Molecular Weight: | 405.49 |
| Molecular Formula: | C18 H19 N3 O4 S2 |
| Smiles: | Cc1ccc(c(c1)NS(c1ccc(c2nnc(C3CCC3)o2)s1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.5131 |
| logD: | 3.4772 |
| logSw: | -3.6122 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.606 |
| InChI Key: | ATKKWMVOEAPCKP-UHFFFAOYSA-N |