N-(3-bromophenyl)-1-(1-methyl-1H-benzotriazole-5-carbonyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3-bromophenyl)-1-(1-methyl-1H-benzotriazole-5-carbonyl)piperidine-4-carboxamide
N-(3-bromophenyl)-1-(1-methyl-1H-benzotriazole-5-carbonyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F634-0233 |
| Compound Name: | N-(3-bromophenyl)-1-(1-methyl-1H-benzotriazole-5-carbonyl)piperidine-4-carboxamide |
| Molecular Weight: | 442.31 |
| Molecular Formula: | C20 H20 Br N5 O2 |
| Smiles: | Cn1c2ccc(cc2nn1)C(N1CCC(CC1)C(Nc1cccc(c1)[Br])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0945 |
| logD: | 2.0938 |
| logSw: | -2.9727 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.962 |
| InChI Key: | JLVYVUMNUHDXBS-UHFFFAOYSA-N |