methyl 4-[(butan-2-yl)sulfamoyl]-1,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-[(butan-2-yl)sulfamoyl]-1,5-dimethyl-1H-pyrrole-2-carboxylate
methyl 4-[(butan-2-yl)sulfamoyl]-1,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F639-0028 |
| Compound Name: | methyl 4-[(butan-2-yl)sulfamoyl]-1,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 288.36 |
| Molecular Formula: | C12 H20 N2 O4 S |
| Smiles: | CCC(C)NS(c1cc(C(=O)OC)n(C)c1C)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.1967 |
| logD: | 1.1965 |
| logSw: | -2.1542 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.13 |
| InChI Key: | ISYYWPFRFSWEJZ-QMMMGPOBSA-N |