methyl 4-{[(4-bromophenyl)methyl]sulfamoyl}-1,5-dimethyl-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-{[(4-bromophenyl)methyl]sulfamoyl}-1,5-dimethyl-1H-pyrrole-2-carboxylate
methyl 4-{[(4-bromophenyl)methyl]sulfamoyl}-1,5-dimethyl-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | F639-0351 |
| Compound Name: | methyl 4-{[(4-bromophenyl)methyl]sulfamoyl}-1,5-dimethyl-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 401.28 |
| Molecular Formula: | C15 H17 Br N2 O4 S |
| Smiles: | Cc1c(cc(C(=O)OC)n1C)S(NCc1ccc(cc1)[Br])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.515 |
| logD: | 2.5145 |
| logSw: | -2.9027 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.203 |
| InChI Key: | CDCBRZLMHVCYEW-UHFFFAOYSA-N |