N-(2-ethoxyphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide
N-(2-ethoxyphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | F640-0164 |
| Compound Name: | N-(2-ethoxyphenyl)-5-(5-methyl-1,3,4-oxadiazol-2-yl)-1H-pyrrole-3-sulfonamide |
| Molecular Weight: | 348.38 |
| Molecular Formula: | C15 H16 N4 O4 S |
| Smiles: | CCOc1ccccc1NS(c1cc(c2nnc(C)o2)[nH]c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8262 |
| logD: | 1.8026 |
| logSw: | -2.6545 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.3 |
| InChI Key: | OWHOUXXLPGWIRT-UHFFFAOYSA-N |