N-(3-methoxyphenyl)-1H-indazole-1-carboxamide
Chemical Structure Depiction of
N-(3-methoxyphenyl)-1H-indazole-1-carboxamide
N-(3-methoxyphenyl)-1H-indazole-1-carboxamide
Compound characteristics
| Compound ID: | F652-0002 |
| Compound Name: | N-(3-methoxyphenyl)-1H-indazole-1-carboxamide |
| Molecular Weight: | 267.28 |
| Molecular Formula: | C15 H13 N3 O2 |
| Smiles: | COc1cccc(c1)NC(n1c2ccccc2cn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1392 |
| logD: | 3.1392 |
| logSw: | -3.4825 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.367 |
| InChI Key: | JBJQKDUVGDNFKU-UHFFFAOYSA-N |