N-(2,4-dimethoxyphenyl)-3-methyl-1H-indazole-1-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-3-methyl-1H-indazole-1-carboxamide
N-(2,4-dimethoxyphenyl)-3-methyl-1H-indazole-1-carboxamide
Compound characteristics
| Compound ID: | F652-0156 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-3-methyl-1H-indazole-1-carboxamide |
| Molecular Weight: | 311.34 |
| Molecular Formula: | C17 H17 N3 O3 |
| Smiles: | Cc1c2ccccc2n(C(Nc2ccc(cc2OC)OC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.0655 |
| logD: | 3.0655 |
| logSw: | -3.477 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.653 |
| InChI Key: | WWKLXFCUNJMNAV-UHFFFAOYSA-N |