N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide
Chemical Structure Depiction of
N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide
N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide
Compound characteristics
| Compound ID: | F653-0158 |
| Compound Name: | N-[2,4-bis(4-methoxyanilino)-6-methylpyrimidin-5-yl]-3-methylbenzamide |
| Molecular Weight: | 469.54 |
| Molecular Formula: | C27 H27 N5 O3 |
| Smiles: | Cc1cccc(c1)C(Nc1c(C)nc(Nc2ccc(cc2)OC)nc1Nc1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.38 |
| logD: | 5.2768 |
| logSw: | -5.4913 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 75.768 |
| InChI Key: | XTQMXILGNUJWFT-UHFFFAOYSA-N |