1-({4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl}methyl)-3-methylquinoxalin-2(1H)-one
Chemical Structure Depiction of
1-({4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl}methyl)-3-methylquinoxalin-2(1H)-one
1-({4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl}methyl)-3-methylquinoxalin-2(1H)-one
Compound characteristics
| Compound ID: | F671-0098 |
| Compound Name: | 1-({4-[4-(4-fluorophenyl)piperazine-1-carbonyl]phenyl}methyl)-3-methylquinoxalin-2(1H)-one |
| Molecular Weight: | 456.52 |
| Molecular Formula: | C27 H25 F N4 O2 |
| Smiles: | [H]c1cc2c(cc1[H])N(Cc1ccc(cc1)C(N1CCN(CC1)c1ccc(cc1)F)=O)C(C(C)=N2)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7069 |
| logD: | 3.7069 |
| logSw: | -3.8831 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.532 |
| InChI Key: | KBVRRFQGCLGIEW-UHFFFAOYSA-N |