N-[(2,4-dimethoxyphenyl)methyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide
Chemical Structure Depiction of
N-[(2,4-dimethoxyphenyl)methyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide
N-[(2,4-dimethoxyphenyl)methyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide
Compound characteristics
| Compound ID: | F671-0365 |
| Compound Name: | N-[(2,4-dimethoxyphenyl)methyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide |
| Molecular Weight: | 471.56 |
| Molecular Formula: | C28 H29 N3 O4 |
| Smiles: | CC1C(N(Cc2ccc(cc2)C(NCc2ccc(cc2OC)OC)=O)c2cc(C)c(C)cc2N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6629 |
| logD: | 4.6629 |
| logSw: | -4.408 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.21 |
| InChI Key: | QOYWHNVPWQIREA-UHFFFAOYSA-N |