N-[2-(furan-2-yl)ethyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide
Chemical Structure Depiction of
N-[2-(furan-2-yl)ethyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide
N-[2-(furan-2-yl)ethyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide
Compound characteristics
| Compound ID: | F671-0373 |
| Compound Name: | N-[2-(furan-2-yl)ethyl]-4-[(3,6,7-trimethyl-2-oxoquinoxalin-1(2H)-yl)methyl]benzamide |
| Molecular Weight: | 415.49 |
| Molecular Formula: | C25 H25 N3 O3 |
| Smiles: | CC1C(N(Cc2ccc(cc2)C(NCCc2ccco2)=O)c2cc(C)c(C)cc2N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9389 |
| logD: | 3.9389 |
| logSw: | -4.018 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.626 |
| InChI Key: | XROYPNJNHHNVFZ-UHFFFAOYSA-N |