N-{6-[(3,4-dimethoxyphenyl)carbamamido]-1,3-benzothiazol-2-yl}benzamide
Chemical Structure Depiction of
N-{6-[(3,4-dimethoxyphenyl)carbamamido]-1,3-benzothiazol-2-yl}benzamide
N-{6-[(3,4-dimethoxyphenyl)carbamamido]-1,3-benzothiazol-2-yl}benzamide
Compound characteristics
| Compound ID: | F690-0214 |
| Compound Name: | N-{6-[(3,4-dimethoxyphenyl)carbamamido]-1,3-benzothiazol-2-yl}benzamide |
| Molecular Weight: | 448.5 |
| Molecular Formula: | C23 H20 N4 O4 S |
| Smiles: | [H]c1cc(cc2c1nc(NC(c1ccccc1)=O)s2)NC(Nc1ccc(c(c1)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9109 |
| logD: | 4.9083 |
| logSw: | -4.7258 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 80.655 |
| InChI Key: | NQBSHJPEJOGBQU-UHFFFAOYSA-N |