N-(3,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperidine-4-carboxamide
N-(3,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F699-0425 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-1-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperidine-4-carboxamide |
| Molecular Weight: | 452.48 |
| Molecular Formula: | C24 H25 F N4 O4 |
| Smiles: | COc1cc(cc(c1)OC)NC(C1CCN(CC1)C1C=CC(N(c2ccc(cc2)F)N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9676 |
| logD: | 2.9657 |
| logSw: | -3.4087 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.884 |
| InChI Key: | PHZSSONBEJVIGJ-UHFFFAOYSA-N |