N-[(2,4-difluorophenyl)methyl]-4-methyl-1-[(4-methylphenyl)acetyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(2,4-difluorophenyl)methyl]-4-methyl-1-[(4-methylphenyl)acetyl]piperidine-4-carboxamide
N-[(2,4-difluorophenyl)methyl]-4-methyl-1-[(4-methylphenyl)acetyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F709-1184 |
| Compound Name: | N-[(2,4-difluorophenyl)methyl]-4-methyl-1-[(4-methylphenyl)acetyl]piperidine-4-carboxamide |
| Molecular Weight: | 400.47 |
| Molecular Formula: | C23 H26 F2 N2 O2 |
| Smiles: | Cc1ccc(CC(N2CCC(C)(CC2)C(NCc2ccc(cc2F)F)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8079 |
| logD: | 3.8079 |
| logSw: | -3.842 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.773 |
| InChI Key: | INJDKWIDUOZTGL-UHFFFAOYSA-N |