N-[(4-fluorophenyl)methyl]-4-methyl-1-[4-(2-methylpropyl)benzene-1-sulfonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-4-methyl-1-[4-(2-methylpropyl)benzene-1-sulfonyl]piperidine-4-carboxamide
N-[(4-fluorophenyl)methyl]-4-methyl-1-[4-(2-methylpropyl)benzene-1-sulfonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F710-0226 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-4-methyl-1-[4-(2-methylpropyl)benzene-1-sulfonyl]piperidine-4-carboxamide |
| Molecular Weight: | 446.58 |
| Molecular Formula: | C24 H31 F N2 O3 S |
| Smiles: | CC(C)Cc1ccc(cc1)S(N1CCC(C)(CC1)C(NCc1ccc(cc1)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9379 |
| logD: | 4.9379 |
| logSw: | -4.4707 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.363 |
| InChI Key: | HNMWYMXGUVWWIZ-UHFFFAOYSA-N |