1-[1-(3-chlorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]-N-[2-(cyclohex-1-en-1-yl)ethyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-[1-(3-chlorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]-N-[2-(cyclohex-1-en-1-yl)ethyl]piperidine-3-carboxamide
1-[1-(3-chlorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]-N-[2-(cyclohex-1-en-1-yl)ethyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | F720-1266 |
| Compound Name: | 1-[1-(3-chlorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]-N-[2-(cyclohex-1-en-1-yl)ethyl]piperidine-3-carboxamide |
| Molecular Weight: | 440.97 |
| Molecular Formula: | C24 H29 Cl N4 O2 |
| Smiles: | C1CCC(CCNC(C2CCCN(C2)C2C=CC(N(c3cccc(c3)[Cl])N=2)=O)=O)=CC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6703 |
| logD: | 3.6702 |
| logSw: | -4.0362 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.085 |
| InChI Key: | YDRJEWHCELGYQC-IBGZPJMESA-N |