N-(4-bromo-3-methylphenyl)-3-{[6-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
Chemical Structure Depiction of
N-(4-bromo-3-methylphenyl)-3-{[6-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
N-(4-bromo-3-methylphenyl)-3-{[6-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
Compound characteristics
| Compound ID: | F725-0052 |
| Compound Name: | N-(4-bromo-3-methylphenyl)-3-{[6-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide |
| Molecular Weight: | 473.37 |
| Molecular Formula: | C25 H21 Br N4 O |
| Smiles: | Cc1cccc(c1)c1cc(Nc2cccc(c2)C(Nc2ccc(c(C)c2)[Br])=O)ncn1 |
| Stereo: | ACHIRAL |
| logP: | 6.9885 |
| logD: | 6.7835 |
| logSw: | -5.7004 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.347 |
| InChI Key: | WSBRTHPODTWTMF-UHFFFAOYSA-N |