N-[(4-fluorophenyl)methyl]-4-[(6-phenylpyrimidin-4-yl)amino]benzamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-4-[(6-phenylpyrimidin-4-yl)amino]benzamide
N-[(4-fluorophenyl)methyl]-4-[(6-phenylpyrimidin-4-yl)amino]benzamide
Compound characteristics
| Compound ID: | F733-1319 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-4-[(6-phenylpyrimidin-4-yl)amino]benzamide |
| Molecular Weight: | 398.44 |
| Molecular Formula: | C24 H19 F N4 O |
| Smiles: | C(c1ccc(cc1)F)NC(c1ccc(cc1)Nc1cc(c2ccccc2)ncn1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8555 |
| logD: | 4.7603 |
| logSw: | -4.9431 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.67 |
| InChI Key: | VPYUSEWDOIUZNE-UHFFFAOYSA-N |