4-ethoxy-N-{3-[2-(5-methyl-1H-benzimidazol-2-yl)ethyl]phenyl}benzamide
Chemical Structure Depiction of
4-ethoxy-N-{3-[2-(5-methyl-1H-benzimidazol-2-yl)ethyl]phenyl}benzamide
4-ethoxy-N-{3-[2-(5-methyl-1H-benzimidazol-2-yl)ethyl]phenyl}benzamide
Compound characteristics
| Compound ID: | F779-0410 |
| Compound Name: | 4-ethoxy-N-{3-[2-(5-methyl-1H-benzimidazol-2-yl)ethyl]phenyl}benzamide |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C25 H25 N3 O2 |
| Smiles: | CCOc1ccc(cc1)C(Nc1cccc(CCc2nc3cc(C)ccc3[nH]2)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5259 |
| logD: | 5.5103 |
| logSw: | -5.3264 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.463 |
| InChI Key: | VSEVIIKZNVAZMN-UHFFFAOYSA-N |