N-{2-[2-(1H-benzimidazol-2-yl)ethyl]phenyl}-5-(3-methylphenyl)-1,3-oxazole-4-carboxamide
Chemical Structure Depiction of
N-{2-[2-(1H-benzimidazol-2-yl)ethyl]phenyl}-5-(3-methylphenyl)-1,3-oxazole-4-carboxamide
N-{2-[2-(1H-benzimidazol-2-yl)ethyl]phenyl}-5-(3-methylphenyl)-1,3-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | F780-6482 |
| Compound Name: | N-{2-[2-(1H-benzimidazol-2-yl)ethyl]phenyl}-5-(3-methylphenyl)-1,3-oxazole-4-carboxamide |
| Molecular Weight: | 422.49 |
| Molecular Formula: | C26 H22 N4 O2 |
| Smiles: | Cc1cccc(c1)c1c(C(Nc2ccccc2CCc2nc3ccccc3[nH]2)=O)nco1 |
| Stereo: | ACHIRAL |
| logP: | 5.5264 |
| logD: | 5.4664 |
| logSw: | -5.4093 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.478 |
| InChI Key: | BMYFTZDTIOUBAW-UHFFFAOYSA-N |