N-(2,4-difluorophenyl)-N'-{2-[(5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}urea
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-N'-{2-[(5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}urea
N-(2,4-difluorophenyl)-N'-{2-[(5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}urea
Compound characteristics
| Compound ID: | F781-0059 |
| Compound Name: | N-(2,4-difluorophenyl)-N'-{2-[(5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)sulfanyl]phenyl}urea |
| Molecular Weight: | 412.42 |
| Molecular Formula: | C19 H14 F2 N6 O S |
| Smiles: | Cc1cc(n2c(ncn2)n1)Sc1ccccc1NC(Nc1ccc(cc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6395 |
| logD: | 3.6381 |
| logSw: | -3.9043 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.657 |
| InChI Key: | ORQAWHKOTPYONC-UHFFFAOYSA-N |