N-(2-butanamido-1,3-benzothiazol-5-yl)-2-methylbenzamide
Chemical Structure Depiction of
N-(2-butanamido-1,3-benzothiazol-5-yl)-2-methylbenzamide
N-(2-butanamido-1,3-benzothiazol-5-yl)-2-methylbenzamide
Compound characteristics
| Compound ID: | F782-2515 |
| Compound Name: | N-(2-butanamido-1,3-benzothiazol-5-yl)-2-methylbenzamide |
| Molecular Weight: | 353.44 |
| Molecular Formula: | C19 H19 N3 O2 S |
| Smiles: | [H]c1cc2c(cc1NC(c1ccccc1C)=O)nc(NC(CCC)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 4.3709 |
| logD: | 4.3544 |
| logSw: | -4.3225 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.24 |
| InChI Key: | PJZMHGPRDBUZFP-UHFFFAOYSA-N |