3-(7,8-dimethoxy-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)-N-(3-methylbutyl)propanamide
Chemical Structure Depiction of
3-(7,8-dimethoxy-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)-N-(3-methylbutyl)propanamide
3-(7,8-dimethoxy-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)-N-(3-methylbutyl)propanamide
Compound characteristics
| Compound ID: | F797-0456 |
| Compound Name: | 3-(7,8-dimethoxy-4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)-N-(3-methylbutyl)propanamide |
| Molecular Weight: | 386.45 |
| Molecular Formula: | C20 H26 N4 O4 |
| Smiles: | CC(C)CCNC(CCN1C=Nc2c3cc(c(cc3[nH]c2C1=O)OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.3435 |
| logD: | 1.3435 |
| logSw: | -1.9725 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.121 |
| InChI Key: | JYOFGIGYEURSEO-UHFFFAOYSA-N |