N-[(2,4-dimethoxyphenyl)methyl]-3-(4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)propanamide
Chemical Structure Depiction of
N-[(2,4-dimethoxyphenyl)methyl]-3-(4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)propanamide
N-[(2,4-dimethoxyphenyl)methyl]-3-(4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)propanamide
Compound characteristics
| Compound ID: | F797-0526 |
| Compound Name: | N-[(2,4-dimethoxyphenyl)methyl]-3-(4-oxo-4,5-dihydro-3H-pyrimido[5,4-b]indol-3-yl)propanamide |
| Molecular Weight: | 406.44 |
| Molecular Formula: | C22 H22 N4 O4 |
| Smiles: | COc1ccc(CNC(CCN2C=Nc3c4ccccc4[nH]c3C2=O)=O)c(c1)OC |
| Stereo: | ACHIRAL |
| logP: | 2.087 |
| logD: | 2.087 |
| logSw: | -2.9625 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.921 |
| InChI Key: | OCWXRTMNPCRPLH-UHFFFAOYSA-N |