N-(2,4-dimethylphenyl)-2-{6-oxo-3-[4-(propan-2-yl)benzene-1-sulfonyl]pyridazin-1(6H)-yl}acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-{6-oxo-3-[4-(propan-2-yl)benzene-1-sulfonyl]pyridazin-1(6H)-yl}acetamide
N-(2,4-dimethylphenyl)-2-{6-oxo-3-[4-(propan-2-yl)benzene-1-sulfonyl]pyridazin-1(6H)-yl}acetamide
Compound characteristics
| Compound ID: | F809-1135 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-{6-oxo-3-[4-(propan-2-yl)benzene-1-sulfonyl]pyridazin-1(6H)-yl}acetamide |
| Molecular Weight: | 439.53 |
| Molecular Formula: | C23 H25 N3 O4 S |
| Smiles: | CC(C)c1ccc(cc1)S(C1C=CC(N(CC(Nc2ccc(C)cc2C)=O)N=1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0109 |
| logD: | 4.0109 |
| logSw: | -4.0163 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.555 |
| InChI Key: | DMPPZMDSXKGYAG-UHFFFAOYSA-N |