N-(3,5-dimethoxyphenyl)-2-[(6-{[(4-fluorophenyl)methyl]amino}pyridazin-3-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-[(6-{[(4-fluorophenyl)methyl]amino}pyridazin-3-yl)sulfanyl]acetamide
N-(3,5-dimethoxyphenyl)-2-[(6-{[(4-fluorophenyl)methyl]amino}pyridazin-3-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | F814-1182 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-[(6-{[(4-fluorophenyl)methyl]amino}pyridazin-3-yl)sulfanyl]acetamide |
| Molecular Weight: | 428.48 |
| Molecular Formula: | C21 H21 F N4 O3 S |
| Smiles: | COc1cc(cc(c1)OC)NC(CSc1ccc(NCc2ccc(cc2)F)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5294 |
| logD: | 3.5292 |
| logSw: | -3.855 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.109 |
| InChI Key: | MDABZJRTIMVDKA-UHFFFAOYSA-N |