1-[4-(azepane-1-carbonyl)thiophene-2-sulfonyl]-N-cycloheptylpiperidine-4-carboxamide
Chemical Structure Depiction of
1-[4-(azepane-1-carbonyl)thiophene-2-sulfonyl]-N-cycloheptylpiperidine-4-carboxamide
1-[4-(azepane-1-carbonyl)thiophene-2-sulfonyl]-N-cycloheptylpiperidine-4-carboxamide
Compound characteristics
| Compound ID: | F817-1611 |
| Compound Name: | 1-[4-(azepane-1-carbonyl)thiophene-2-sulfonyl]-N-cycloheptylpiperidine-4-carboxamide |
| Molecular Weight: | 495.7 |
| Molecular Formula: | C24 H37 N3 O4 S2 |
| Smiles: | C1CCCC(CC1)NC(C1CCN(CC1)S(c1cc(cs1)C(N1CCCCCC1)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7331 |
| logD: | 3.7331 |
| logSw: | -3.7808 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.417 |
| InChI Key: | ZKIMIHGWBWLOSL-UHFFFAOYSA-N |